5,6,7,8-Tetrahydrofolate (thf)

Human Metabolome Database (HMDB): Tetrahydrofolic acid, also known as (6s)-tetrahydrofolate or (6s)-thfa, belongs to glutamic acid and derivatives class of compounds. Those are compounds containing glutamic acid or a derivative thereof resulting from reaction of glutamic acid at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom. Tetrahydrofolic acid is practically insoluble (in water) and a weakly acidic compound (based on its pKa). Tetrahydrofolic acid can be found in a number of food items such as malabar plum, parsnip, white lupine, and alpine sweetvetch, which makes tetrahydrofolic acid a potential biomarker for the consumption of these food products. Tetrahydrofolic acid may be a unique S.cerevisiae (yeast) metabolite. Tetrahydrofolic acid is a drug which is used for nutritional supplementation, also for treating dietary shortage or imbalance. Tetrahydrofolate is transported across cells by receptor-mediated endocytosis where it is needed to maintain normal erythropoiesis, synthesize purine and thymidylate nucleic acids, interconvert amino acids, methylate tRNA, and generate and use formate (DrugBank).

Charged formula:

C19H21N7O6

Charge:

-2

InChIKey:

MSTNYGQPCMXVAQ-RYUDHWBXSA-L

SMILES:

[H]/N=c1/nc([O-])c2c(n1[H])N([H])C([H])([H])[C@]([H])(C([H])([H])N([H])c1c([H])c([H])c(C(=O)N([H])[C@]([H])(C(=O)O[H])C([H])([H])C([H])([H])C(=O)[O-])c([H])c1[H])N2[H]

External links: hmdb.cakegg.jpebi.ac.ukpubchem.ncbi.nlm.nih.gov

Loading the full metabolite page…