Beta-D-glucose-6-Phosphate (g6p_B)

Human Metabolome Database (HMDB): beta-D-Glucose 6 phosphate (b-G6P) is the beta-anomer of glucose-6-phosphate. There are two anomers of glucose 6 phosphate: the alpha anomer and the beta anomer. Specifically, beta-D-Glucose 6-phosphate is glucose sugar phosphorylated on carbon 6. It is a very common metabolite in cells as the vast majority of glucose entering a cell will become phosphorylated in this way. The primary reason for the immediate phosphorylation of glucose is to prevent diffusion out of the cell. The phosphorylation adds a charged phosphate group so the glucose 6-phosphate cannot easily cross the cell membrane. b-G6P is involved in glycolysis, gluconeogenesis, pentose phosphate, and glycogen and sucrose metabolic pathways. beta-D-Glucose 6 phosphate can be generated through beta-D-fructose phosphate or alpha-D-glucose 6 phosphate (via glucose-6-phosphate isomerase) or beta-D glucose (via hexokinase). It can then be sent off to the pentose phosphate pathway which generates the useful cofactor NADPH as well as ribulose 5-phosphate, a carbon source for the synthesis of other molecules. Alternately, if the cell needs energy or carbon skeletons for synthesis then glucose 6-phosphate is targeted for glycolysis. A third route is to have glucose 6 phosphate stored or converted into glycogen, especially if blood glucose levels are high.

Charged formula:
C6H11O9P
Charge:
-2
InChIKey:
NBSCHQHZLSJFNQ-VFUOTHLCSA-L
SMILES:
[H]O[C@]1([H])O[C@]([H])(C([H])([H])OP(=O)([O-])[O-])[C@@]([H])(O[H])[C@]([H])(O[H])[C@@]1([H])O[H]

External links: hmdb.cakegg.jpebi.ac.ukpubchem.ncbi.nlm.nih.gov

Loading the full metabolite page…

Feedback